C19H24N4O4 — CID 46573508
1-pyrazin-2-yl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide (PubChem CID 46573508) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-pyrazin-2-yl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-pyrazin-2-yl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46573508 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-pyrazin-2-yl-N-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCCN(c3cnccn3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H24N4O4/c1-25-15-9-14(10-16(26-2)18(15)27-3)22-19(24)13-5-4-8-23(12-13)17-11-20-6-7-21-17/h6-7,9-11,13H,4-5,8,12H2,1-3H3,(H,22,24) |
| InChIKey | QPPWQUUMSSEXGM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |