C17H16ClN5O — CID 46576736
(2-chloro-4-pyridinyl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 46576736) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46576736 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCC(c2nnc3ccccn23)CC1 |
| InChI | InChI=1S/C17H16ClN5O/c18-14-11-13(4-7-19-14)17(24)22-9-5-12(6-10-22)16-21-20-15-3-1-2-8-23(15)16/h1-4,7-8,11-12H,5-6,9-10H2 |
| InChIKey | BNVSTGGAAPATIX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|