C18H28N2O4 — CID 4657940
N-[(2,4,5-trimethoxyphenyl)methylideneamino]octanamide (PubChem CID 4657940) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[(2,4,5-trimethoxyphenyl)methylideneamino]octanamide.
| Compound Name | N-[(2,4,5-trimethoxyphenyl)methylideneamino]octanamide |
|---|---|
| PubChem CID | 4657940 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(2,4,5-trimethoxyphenyl)methylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)NN=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C18H28N2O4/c1-5-6-7-8-9-10-18(21)20-19-13-14-11-16(23-3)17(24-4)12-15(14)22-2/h11-13H,5-10H2,1-4H3,(H,20,21) |
| InChIKey | WUTCTWAWRWGPNH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|