C18H19BrClNO3 — CID 46580574
4-bromo-N-[1-(4-chlorophenyl)ethyl]-3,5-dimethoxy-N-methylbenzamide (PubChem CID 46580574) has the molecular formula C18H19BrClNO3 and a molecular weight of 412.71 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-chlorophenyl)ethyl]-3,5-dimethoxy-N-methylbenzamide.
| Compound Name | 4-bromo-N-[1-(4-chlorophenyl)ethyl]-3,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 46580574 |
| Molecular Formula | C18H19BrClNO3 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 4-bromo-N-[1-(4-chlorophenyl)ethyl]-3,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)C(C)c2ccc(Cl)cc2)cc(OC)c1Br |
| InChI | InChI=1S/C18H19BrClNO3/c1-11(12-5-7-14(20)8-6-12)21(2)18(22)13-9-15(23-3)17(19)16(10-13)24-4/h5-11H,1-4H3 |
| InChIKey | RQHBGWIJDGHLOS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |