C19H24BrN3O4 — CID 46581539
ethyl 4-[[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 46581539) has the molecular formula C19H24BrN3O4 and a molecular weight of 438.32 g/mol. Its IUPAC name is ethyl 4-[[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46581539 |
| Molecular Formula | C19H24BrN3O4 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl 4-[[1-(2-bromophenyl)-5-oxopyrrolidine-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2CC(=O)N(c3ccccc3Br)C2)CC1 |
| InChI | InChI=1S/C19H24BrN3O4/c1-2-27-19(26)22-9-7-14(8-10-22)21-18(25)13-11-17(24)23(12-13)16-6-4-3-5-15(16)20/h3-6,13-14H,2,7-12H2,1H3,(H,21,25) |
| InChIKey | HGPNTIYQBKZRFS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |