C19H18ClFN2O2 — CID 46584016
1-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 46584016) has the molecular formula C19H18ClFN2O2 and a molecular weight of 360.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46584016 |
| Molecular Formula | C19H18ClFN2O2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)C1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H18ClFN2O2/c20-15-2-1-3-17(11-15)23-12-14(10-18(23)24)19(25)22-9-8-13-4-6-16(21)7-5-13/h1-7,11,14H,8-10,12H2,(H,22,25) |
| InChIKey | NUTTVNNPVUAYID-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |