C18H19N3O4 — CID 46584301
1-(2,5-dimethoxyphenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide (PubChem CID 46584301) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46584301 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(N2CC(C(=O)Nc3cccnc3)CC2=O)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-24-14-5-6-16(25-2)15(9-14)21-11-12(8-17(21)22)18(23)20-13-4-3-7-19-10-13/h3-7,9-10,12H,8,11H2,1-2H3,(H,20,23) |
| InChIKey | LWMKWGJDBLMTLI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |