C21H18FN3O2 — CID 46584396
N-[1-(1-benzofuran-2-yl)ethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 46584396) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46584396 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)c2cc3ccccc3o2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FN3O2/c1-13(20-11-15-5-3-4-6-19(15)27-20)24-21(26)18-12-23-25(14(18)2)17-9-7-16(22)8-10-17/h3-13H,1-2H3,(H,24,26) |
| InChIKey | PXNBOUGYOPNVTM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |