C18H20ClNO3S2 — CID 46584501
3-(4-chlorophenyl)sulfonyl-N-(3-phenylsulfanylpropyl)propanamide (PubChem CID 46584501) has the molecular formula C18H20ClNO3S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-(3-phenylsulfanylpropyl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-(3-phenylsulfanylpropyl)propanamide |
|---|---|
| PubChem CID | 46584501 |
| Molecular Formula | C18H20ClNO3S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-(3-phenylsulfanylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Cl)cc1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C18H20ClNO3S2/c19-15-7-9-17(10-8-15)25(22,23)14-11-18(21)20-12-4-13-24-16-5-2-1-3-6-16/h1-3,5-10H,4,11-14H2,(H,20,21) |
| InChIKey | DFWAKQSGVZALGF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|