C9H5Br2F6NO3S — CID 4658506
1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-3,5-dibromobenzenesulfonate (PubChem CID 4658506) has the molecular formula C9H5Br2F6NO3S and a molecular weight of 481.01 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-3,5-dibromobenzenesulfonate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-3,5-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 4658506 |
| Molecular Formula | C9H5Br2F6NO3S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 478.83 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-amino-3,5-dibromobenzenesulfonate |
| SMILES | Nc1c(Br)cc(S(=O)(=O)OC(C(F)(F)F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H5Br2F6NO3S/c10-4-1-3(2-5(11)6(4)18)22(19,20)21-7(8(12,13)14)9(15,16)17/h1-2,7H,18H2 |
| InChIKey | LHCIBRRUFMPRDZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|