About 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide
5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 46586182) has the molecular formula C18H17FN4O2
and a molecular weight of 340.36 g/mol. Its IUPAC name is 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| PubChem CID | 46586182 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)NCc2cccc(F)c2)=NN1c1ccccc1 |
| InChI | InChI=1S/C18H17FN4O2/c19-13-6-4-5-12(9-13)11-21-18(25)15-10-16(17(20)24)23(22-15)14-7-2-1-3-8-14/h1-9,16H,10-11H2,(H2,20,24)(H,21,25) |
| InChIKey | PJMNYJAEVYXAIJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The IUPAC name of 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (CID 46586182) is 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
What is the SMILES notation for 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The canonical SMILES for 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide is NC(=O)C1CC(C(=O)NCc2cccc(F)c2)=NN1c1ccccc1.
What is the InChIKey of 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The InChIKey is PJMNYJAEVYXAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4O2/c19-13-6-4-5-12(9-13)11-21-18(25)15-10-16(17(20)24)23(22-15)14-7-2-1-3-8-14/h1-9,16H,10-11H2,(H2,20,24)(H,21,25).
What are the key properties of 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide has a molecular weight of 340.36 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[(3-fluorophenyl)methyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide is sourced from PubChem (CID 46586182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).