C22H28N2O6 — CID 46586806
N-[2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 46586806) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 46586806 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[2-[(2,3-dimethoxyphenyl)methylamino]-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)NCc2cccc(OC)c2OC)cc1OCC |
| InChI | InChI=1S/C22H28N2O6/c1-5-29-17-11-10-15(12-19(17)30-6-2)22(26)24-14-20(25)23-13-16-8-7-9-18(27-3)21(16)28-4/h7-12H,5-6,13-14H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | XLIKXGMHDVRVSY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |