C18H14BrF3N2O3 — CID 46587243
1-(2-bromophenyl)-5-oxo-N-[2-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 46587243) has the molecular formula C18H14BrF3N2O3 and a molecular weight of 443.22 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-oxo-N-[2-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-bromophenyl)-5-oxo-N-[2-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46587243 |
| Molecular Formula | C18H14BrF3N2O3 |
| Molecular Weight | 443.22 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 1-(2-bromophenyl)-5-oxo-N-[2-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)C1CC(=O)N(c2ccccc2Br)C1 |
| InChI | InChI=1S/C18H14BrF3N2O3/c19-12-5-1-3-7-14(12)24-10-11(9-16(24)25)17(26)23-13-6-2-4-8-15(13)27-18(20,21)22/h1-8,11H,9-10H2,(H,23,26) |
| InChIKey | PXGSFLKENQEILB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |