C24H25FN2O3 — CID 46588810
3-ethoxy-N-ethyl-N-[(3-fluorophenyl)methyl]-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 46588810) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-N-[(3-fluorophenyl)methyl]-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 3-ethoxy-N-ethyl-N-[(3-fluorophenyl)methyl]-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46588810 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-ethoxy-N-ethyl-N-[(3-fluorophenyl)methyl]-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)N(CC)Cc2cccc(F)c2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C24H25FN2O3/c1-3-27(16-18-7-5-9-21(25)13-18)24(28)20-10-11-22(23(14-20)29-4-2)30-17-19-8-6-12-26-15-19/h5-15H,3-4,16-17H2,1-2H3 |
| InChIKey | GVHZHHUXDXIMPG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |