About 5-ethyl-1,2-dihydropyrazol-3-one
5-ethyl-1,2-dihydropyrazol-3-one (PubChem CID 4658963) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 5-ethyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-ethyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 4658963 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 5-ethyl-1,2-dihydropyrazol-3-one |
| SMILES | CCc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C5H8N2O/c1-2-4-3-5(8)7-6-4/h3H,2H2,1H3,(H2,6,7,8) |
| InChIKey | OBTFNIOWJJRVQV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-ethyl-1,2-dihydropyrazol-3-one (CID 4658963) is 5-ethyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-ethyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-ethyl-1,2-dihydropyrazol-3-one is CCc1cc(=O)[nH][nH]1.
What is the InChIKey of 5-ethyl-1,2-dihydropyrazol-3-one?
The InChIKey is OBTFNIOWJJRVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-2-4-3-5(8)7-6-4/h3H,2H2,1H3,(H2,6,7,8).
What are the key properties of 5-ethyl-1,2-dihydropyrazol-3-one?
5-ethyl-1,2-dihydropyrazol-3-one has a molecular weight of 112.13 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 4658963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).