C12H28N4 — CID 4659299
1,8-dimethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 4659299) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,8-dimethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1,8-dimethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 4659299 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1,8-dimethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CN1CCCNCCN(C)CCCNCC1 |
| InChI | InChI=1S/C12H28N4/c1-15-9-3-5-14-8-12-16(2)10-4-6-13-7-11-15/h13-14H,3-12H2,1-2H3 |
| InChIKey | BNLDMZVBFXARKJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |