C24H22ClN5O2S — CID 46593592
1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 46593592) has the molecular formula C24H22ClN5O2S and a molecular weight of 479.99 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 46593592 |
| Molecular Formula | C24H22ClN5O2S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(SCc3coc(-c4cccc(Cl)c4)n3)nnc12 |
| InChI | InChI=1S/C24H22ClN5O2S/c1-2-3-6-12-29-22(31)19-10-4-5-11-20(19)30-23(29)27-28-24(30)33-15-18-14-32-21(26-18)16-8-7-9-17(25)13-16/h4-5,7-11,13-14H,2-3,6,12,15H2,1H3 |
| InChIKey | GMXDSDPUZKRHNX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|