C17H23N3O2S — CID 46594275
3-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(3,5-dimethylphenyl)-1,3,4-oxadiazole-2-thione (PubChem CID 46594275) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(3,5-dimethylphenyl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(3,5-dimethylphenyl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 46594275 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-[(2,5-dimethylmorpholin-4-yl)methyl]-5-(3,5-dimethylphenyl)-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1cc(C)cc(-c2nn(CN3CC(C)OCC3C)c(=S)o2)c1 |
| InChI | InChI=1S/C17H23N3O2S/c1-11-5-12(2)7-15(6-11)16-18-20(17(23)22-16)10-19-8-14(4)21-9-13(19)3/h5-7,13-14H,8-10H2,1-4H3 |
| InChIKey | LAOKFCKFNZIYEI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|