C17H16ClN3O2 — CID 46594402
3-chloro-N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 46594402) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 3-chloro-N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 3-chloro-N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 46594402 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-chloro-N-[[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | CCOc1ccc(-c2noc(CNc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C17H16ClN3O2/c1-2-22-15-8-6-12(7-9-15)17-20-16(23-21-17)11-19-14-5-3-4-13(18)10-14/h3-10,19H,2,11H2,1H3 |
| InChIKey | FZJGMADRZCTJJQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |