C16H24N2O4 — CID 46595482
N-(2,5-dimethoxyphenyl)-2-(2,5-dimethylmorpholin-4-yl)acetamide (PubChem CID 46595482) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2,5-dimethylmorpholin-4-yl)acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2,5-dimethylmorpholin-4-yl)acetamide |
|---|---|
| PubChem CID | 46595482 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2,5-dimethylmorpholin-4-yl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CN2CC(C)OCC2C)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-11-10-22-12(2)8-18(11)9-16(19)17-14-7-13(20-3)5-6-15(14)21-4/h5-7,11-12H,8-10H2,1-4H3,(H,17,19) |
| InChIKey | FBZTZWBEMHMAOR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |