C14H21N3O4S — CID 46595994
N-[3-[1-(morpholin-4-ylsulfonylamino)ethyl]phenyl]acetamide (PubChem CID 46595994) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[3-[1-(morpholin-4-ylsulfonylamino)ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-(morpholin-4-ylsulfonylamino)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46595994 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[3-[1-(morpholin-4-ylsulfonylamino)ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(C)NS(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C14H21N3O4S/c1-11(13-4-3-5-14(10-13)15-12(2)18)16-22(19,20)17-6-8-21-9-7-17/h3-5,10-11,16H,6-9H2,1-2H3,(H,15,18) |
| InChIKey | QFUCYKMHDHTSFH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |