About 2-hydroxypropanimidamide
2-hydroxypropanimidamide (PubChem CID 4659740) has the molecular formula C3H8N2O
and a molecular weight of 88.11 g/mol. Its IUPAC name is 2-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-hydroxypropanimidamide |
| PubChem CID | 4659740 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | 2-hydroxypropanimidamide |
| SMILES | [H]/N=C(\N)C(C)O |
| InChI | InChI=1S/C3H8N2O/c1-2(6)3(4)5/h2,6H,1H3,(H3,4,5) |
| InChIKey | HLGDWKWUYZNZIF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanimidamide?
The IUPAC name of 2-hydroxypropanimidamide (CID 4659740) is 2-hydroxypropanimidamide.
What is the SMILES notation for 2-hydroxypropanimidamide?
The canonical SMILES for 2-hydroxypropanimidamide is [H]/N=C(\N)C(C)O.
What is the InChIKey of 2-hydroxypropanimidamide?
The InChIKey is HLGDWKWUYZNZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O/c1-2(6)3(4)5/h2,6H,1H3,(H3,4,5).
What are the key properties of 2-hydroxypropanimidamide?
2-hydroxypropanimidamide has a molecular weight of 88.11 g/mol, XLogP of -0.70, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanimidamide is sourced from PubChem (CID 4659740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).