About 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol
2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol (PubChem CID 4659881) has the molecular formula C17H17BrClNO
and a molecular weight of 366.69 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol |
| PubChem CID | 4659881 |
| Molecular Formula | C17H17BrClNO |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol |
| SMILES | Cc1ccc(/N=C/c2c(C)c(Cl)c(C)c(Br)c2O)cc1C |
| InChI | InChI=1S/C17H17BrClNO/c1-9-5-6-13(7-10(9)2)20-8-14-11(3)16(19)12(4)15(18)17(14)21/h5-8,21H,1-4H3/b20-8+ |
| InChIKey | XDCWACFEXPHGBX-DNTJNYDQSA-N |
| XLogP | 5.79 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol?
The IUPAC name of 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol (CID 4659881) is 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol.
What is the SMILES notation for 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol?
The canonical SMILES for 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol is Cc1ccc(/N=C/c2c(C)c(Cl)c(C)c(Br)c2O)cc1C.
What is the InChIKey of 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol?
The InChIKey is XDCWACFEXPHGBX-DNTJNYDQSA-N. The full InChI is InChI=1S/C17H17BrClNO/c1-9-5-6-13(7-10(9)2)20-8-14-11(3)16(19)12(4)15(18)17(14)21/h5-8,21H,1-4H3/b20-8+.
What are the key properties of 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol?
2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol has a molecular weight of 366.69 g/mol, XLogP of 5.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-chloro-6-[(3,4-dimethylphenyl)iminomethyl]-3,5-dimethylphenol is sourced from PubChem (CID 4659881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).