C21H20FNO2 — CID 46599158
2-(3-fluoro-4-methoxyphenyl)-N-(1-naphthalen-2-ylethyl)acetamide (PubChem CID 46599158) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-N-(1-naphthalen-2-ylethyl)acetamide.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-N-(1-naphthalen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 46599158 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-N-(1-naphthalen-2-ylethyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC(C)c2ccc3ccccc3c2)cc1F |
| InChI | InChI=1S/C21H20FNO2/c1-14(17-9-8-16-5-3-4-6-18(16)13-17)23-21(24)12-15-7-10-20(25-2)19(22)11-15/h3-11,13-14H,12H2,1-2H3,(H,23,24) |
| InChIKey | QCBKKSGTWPKWQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |