C20H18ClFN2OS — CID 4660343
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-cyclopentylquinazolin-4-one (PubChem CID 4660343) has the molecular formula C20H18ClFN2OS and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-cyclopentylquinazolin-4-one.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-cyclopentylquinazolin-4-one |
|---|---|
| PubChem CID | 4660343 |
| Molecular Formula | C20H18ClFN2OS |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-cyclopentylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2c(F)cccc2Cl)n1C1CCCC1 |
| InChI | InChI=1S/C20H18ClFN2OS/c21-16-9-5-10-17(22)15(16)12-26-20-23-18-11-4-3-8-14(18)19(25)24(20)13-6-1-2-7-13/h3-5,8-11,13H,1-2,6-7,12H2 |
| InChIKey | QXMWTWPMSCNBJM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |