C18H17N7OS2 — CID 46603632
2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone (PubChem CID 46603632) has the molecular formula C18H17N7OS2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 46603632 |
| Molecular Formula | C18H17N7OS2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cn1c(-c2cccs2)n[nH]c1=S)N1CCCC1c1nnc2ccccn12 |
| InChI | InChI=1S/C18H17N7OS2/c26-15(11-25-17(21-22-18(25)27)13-6-4-10-28-13)23-9-3-5-12(23)16-20-19-14-7-1-2-8-24(14)16/h1-2,4,6-8,10,12H,3,5,9,11H2,(H,22,27) |
| InChIKey | VNQLPABLHBXVHT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|