C12H13ClN6O3 — CID 4660436
2-[[6-amino-2-(3-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanol (PubChem CID 4660436) has the molecular formula C12H13ClN6O3 and a molecular weight of 324.73 g/mol. Its IUPAC name is 2-[[6-amino-2-(3-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[6-amino-2-(3-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 4660436 |
| Molecular Formula | C12H13ClN6O3 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[[6-amino-2-(3-chloroanilino)-5-nitropyrimidin-4-yl]amino]ethanol |
| SMILES | Nc1nc(Nc2cccc(Cl)c2)nc(NCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN6O3/c13-7-2-1-3-8(6-7)16-12-17-10(14)9(19(21)22)11(18-12)15-4-5-20/h1-3,6,20H,4-5H2,(H4,14,15,16,17,18) |
| InChIKey | TZLRGFTYOCMVES-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|