About dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate
dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate (PubChem CID 4660560) has the molecular formula C35H24O8
and a molecular weight of 572.57 g/mol. Its IUPAC name is dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate |
| PubChem CID | 4660560 |
| Molecular Formula | C35H24O8 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc2c(c1)C(=O)c1ccccc1C2=O)(Cc1ccc2c(c1)C(=O)c1ccccc1C2=O)C(=O)OC |
| InChI | InChI=1S/C35H24O8/c1-42-33(40)35(34(41)43-2,17-19-11-13-25-27(15-19)31(38)23-9-5-3-7-21(23)29(25)36)18-20-12-14-26-28(16-20)32(39)24-10-6-4-8-22(24)30(26)37/h3-16H,17-18H2,1-2H3 |
| InChIKey | QMOXYMMCCBRYKD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate?
The IUPAC name of dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate (CID 4660560) is dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate.
What is the SMILES notation for dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate?
The canonical SMILES for dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate is COC(=O)C(Cc1ccc2c(c1)C(=O)c1ccccc1C2=O)(Cc1ccc2c(c1)C(=O)c1ccccc1C2=O)C(=O)OC.
What is the InChIKey of dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate?
The InChIKey is QMOXYMMCCBRYKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H24O8/c1-42-33(40)35(34(41)43-2,17-19-11-13-25-27(15-19)31(38)23-9-5-3-7-21(23)29(25)36)18-20-12-14-26-28(16-20)32(39)24-10-6-4-8-22(24)30(26)37/h3-16H,17-18H2,1-2H3.
What are the key properties of dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate?
dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate has a molecular weight of 572.57 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,2-bis[(9,10-dioxoanthracen-2-yl)methyl]propanedioate is sourced from PubChem (CID 4660560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).