C26H24N4O3S — CID 46606044
N-(2-ethylphenyl)-2-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]amino]acetamide (PubChem CID 46606044) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]amino]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]amino]acetamide |
|---|---|
| PubChem CID | 46606044 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-(2-ethylphenyl)-2-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]amino]acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O3S/c1-2-18-10-6-8-14-21(18)28-23(31)16-27-24(32)17-34-26-29-22-15-9-7-13-20(22)25(33)30(26)19-11-4-3-5-12-19/h3-15H,2,16-17H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | MFDCCTFOUICUNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |