C17H25ClN2O3 — CID 46607912
5-chloro-2-[2-(6-methylheptan-2-ylamino)-2-oxoethoxy]benzamide (PubChem CID 46607912) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 5-chloro-2-[2-(6-methylheptan-2-ylamino)-2-oxoethoxy]benzamide.
| Compound Name | 5-chloro-2-[2-(6-methylheptan-2-ylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 46607912 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-chloro-2-[2-(6-methylheptan-2-ylamino)-2-oxoethoxy]benzamide |
| SMILES | CC(C)CCCC(C)NC(=O)COc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C17H25ClN2O3/c1-11(2)5-4-6-12(3)20-16(21)10-23-15-8-7-13(18)9-14(15)17(19)22/h7-9,11-12H,4-6,10H2,1-3H3,(H2,19,22)(H,20,21) |
| InChIKey | OBAIKSXAYQFNFZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |