C22H20FNO3S — CID 46608832
[2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)acetate (PubChem CID 46608832) has the molecular formula C22H20FNO3S and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)acetate.
| Compound Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 46608832 |
| Molecular Formula | C22H20FNO3S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)OCC(=O)NC(c2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H20FNO3S/c1-15-4-6-16(7-5-15)13-21(26)27-14-20(25)24-22(19-3-2-12-28-19)17-8-10-18(23)11-9-17/h2-12,22H,13-14H2,1H3,(H,24,25) |
| InChIKey | IRMAEEGTLXOWRE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |