About 2,2-dimethyldecane-3,4-dione
2,2-dimethyldecane-3,4-dione (PubChem CID 4661084) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,2-dimethyldecane-3,4-dione.
Molecular Properties
| Compound Name | 2,2-dimethyldecane-3,4-dione |
| PubChem CID | 4661084 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,2-dimethyldecane-3,4-dione |
| SMILES | CCCCCCC(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-5-6-7-8-9-10(13)11(14)12(2,3)4/h5-9H2,1-4H3 |
| InChIKey | URRUIURDAWKKSV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyldecane-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyldecane-3,4-dione?
The IUPAC name of 2,2-dimethyldecane-3,4-dione (CID 4661084) is 2,2-dimethyldecane-3,4-dione.
What is the SMILES notation for 2,2-dimethyldecane-3,4-dione?
The canonical SMILES for 2,2-dimethyldecane-3,4-dione is CCCCCCC(=O)C(=O)C(C)(C)C.
What is the InChIKey of 2,2-dimethyldecane-3,4-dione?
The InChIKey is URRUIURDAWKKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-5-6-7-8-9-10(13)11(14)12(2,3)4/h5-9H2,1-4H3.
What are the key properties of 2,2-dimethyldecane-3,4-dione?
2,2-dimethyldecane-3,4-dione has a molecular weight of 198.31 g/mol, XLogP of 3.14, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyldecane-3,4-dione is sourced from PubChem (CID 4661084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).