C22H24ClFN2O5S — CID 46610985
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate (PubChem CID 46610985) has the molecular formula C22H24ClFN2O5S and a molecular weight of 482.96 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46610985 |
| Molecular Formula | C22H24ClFN2O5S |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)OCC(=O)Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C22H24ClFN2O5S/c1-26(17-5-3-2-4-6-17)32(29,30)18-10-7-15(8-11-18)22(28)31-14-21(27)25-20-12-9-16(24)13-19(20)23/h7-13,17H,2-6,14H2,1H3,(H,25,27) |
| InChIKey | LEPCQUNXOVIXKT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |