C17H12N6O8 — CID 4661288
2-(4,5-dinitroimidazol-1-yl)-N-(3-nitro-5-phenoxyphenyl)acetamide (PubChem CID 4661288) has the molecular formula C17H12N6O8 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-(4,5-dinitroimidazol-1-yl)-N-(3-nitro-5-phenoxyphenyl)acetamide.
| Compound Name | 2-(4,5-dinitroimidazol-1-yl)-N-(3-nitro-5-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4661288 |
| Molecular Formula | C17H12N6O8 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-(4,5-dinitroimidazol-1-yl)-N-(3-nitro-5-phenoxyphenyl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-])Nc1cc(Oc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12N6O8/c24-15(9-20-10-18-16(22(27)28)17(20)23(29)30)19-11-6-12(21(25)26)8-14(7-11)31-13-4-2-1-3-5-13/h1-8,10H,9H2,(H,19,24) |
| InChIKey | VDIJECJEMCBPPP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 185.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|