C22H36N2O4S — CID 46613224
N-(3-cyclohexyloxypropyl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide (PubChem CID 46613224) has the molecular formula C22H36N2O4S and a molecular weight of 424.61 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 46613224 |
| Molecular Formula | C22H36N2O4S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(C)C)C(=O)NCCCOC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H36N2O4S/c1-17(2)16-21(24-29(26,27)20-12-10-18(3)11-13-20)22(25)23-14-7-15-28-19-8-5-4-6-9-19/h10-13,17,19,21,24H,4-9,14-16H2,1-3H3,(H,23,25) |
| InChIKey | VXDGLOCTVLONOT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|