About methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate
methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 4661376) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate |
| PubChem CID | 4661376 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C(=O)CC(=O)CC1C |
| InChI | InChI=1S/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h5,8H,3-4H2,1-2H3 |
| InChIKey | YOELNWPMMURSQH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate?
The IUPAC name of methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate (CID 4661376) is methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate.
What is the SMILES notation for methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate?
The canonical SMILES for methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate is COC(=O)C1C(=O)CC(=O)CC1C.
What is the InChIKey of methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate?
The InChIKey is YOELNWPMMURSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h5,8H,3-4H2,1-2H3.
What are the key properties of methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate?
methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate has a molecular weight of 184.19 g/mol, XLogP of 0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-4,6-dioxocyclohexane-1-carboxylate is sourced from PubChem (CID 4661376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).