C24H29N4O4S+ — CID 4661460
benzyl-methyl-[3-[4-(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoylamino]propyl]azanium (PubChem CID 4661460) has the molecular formula C24H29N4O4S+ and a molecular weight of 469.59 g/mol. Its IUPAC name is benzyl-methyl-[3-[4-(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoylamino]propyl]azanium.
| Compound Name | benzyl-methyl-[3-[4-(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoylamino]propyl]azanium |
|---|---|
| PubChem CID | 4661460 |
| Molecular Formula | C24H29N4O4S+ |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | benzyl-methyl-[3-[4-(8-oxo-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoylamino]propyl]azanium |
| SMILES | C[NH+](CCCNC(=O)CCCn1c(=S)[nH]c2cc3c(cc2c1=O)OCO3)Cc1ccccc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-27(15-17-7-3-2-4-8-17)11-6-10-25-22(29)9-5-12-28-23(30)18-13-20-21(32-16-31-20)14-19(18)26-24(28)33/h2-4,7-8,13-14H,5-6,9-12,15-16H2,1H3,(H,25,29)(H,26,33)/p+1 |
| InChIKey | RKRLDHMXCSOLKB-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|