C19H21N3O4S — CID 46616489
N-methyl-4-[4-(thiophene-3-carbonylamino)butanoyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 46616489) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-methyl-4-[4-(thiophene-3-carbonylamino)butanoyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-methyl-4-[4-(thiophene-3-carbonylamino)butanoyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 46616489 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-methyl-4-[4-(thiophene-3-carbonylamino)butanoyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(C(=O)CCCNC(=O)c2ccsc2)c2ccccc2O1 |
| InChI | InChI=1S/C19H21N3O4S/c1-20-19(25)16-11-22(14-5-2-3-6-15(14)26-16)17(23)7-4-9-21-18(24)13-8-10-27-12-13/h2-3,5-6,8,10,12,16H,4,7,9,11H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | JTFIJTJTFFTGJP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|