About N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide (PubChem CID 4661679) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide |
| PubChem CID | 4661679 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)C2CC3CCC2C3)c(C)c1 |
| InChI | InChI=1S/C18H25NO/c1-11-4-7-16(12(2)8-11)18(20)19-13(3)17-10-14-5-6-15(17)9-14/h4,7-8,13-15,17H,5-6,9-10H2,1-3H3,(H,19,20) |
| InChIKey | IKUBFGZYUXDDRM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide?
The IUPAC name of N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide (CID 4661679) is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide.
What is the SMILES notation for N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide?
The canonical SMILES for N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide is Cc1ccc(C(=O)NC(C)C2CC3CCC2C3)c(C)c1.
What is the InChIKey of N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide?
The InChIKey is IKUBFGZYUXDDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO/c1-11-4-7-16(12(2)8-11)18(20)19-13(3)17-10-14-5-6-15(17)9-14/h4,7-8,13-15,17H,5-6,9-10H2,1-3H3,(H,19,20).
What are the key properties of N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide?
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide has a molecular weight of 271.40 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2,4-dimethylbenzamide is sourced from PubChem (CID 4661679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).