C15H11BrN2O2S — CID 4661848
2-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoic acid (PubChem CID 4661848) has the molecular formula C15H11BrN2O2S and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoic acid.
| Compound Name | 2-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 4661848 |
| Molecular Formula | C15H11BrN2O2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-[(3-bromoimidazo[1,2-a]pyridin-2-yl)methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SCc1nc2ccccn2c1Br |
| InChI | InChI=1S/C15H11BrN2O2S/c16-14-11(17-13-7-3-4-8-18(13)14)9-21-12-6-2-1-5-10(12)15(19)20/h1-8H,9H2,(H,19,20) |
| InChIKey | MQSHEFPBVPIQSA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |