C24H29N3O4S2 — CID 46619267
N-(3,4-dimethoxyphenyl)-2-[(3-ethyl-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 46619267) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[(3-ethyl-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[(3-ethyl-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46619267 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[(3-ethyl-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCn1c(SC(C)C(=O)Nc2ccc(OC)c(OC)c2)nc2sc3c(c2c1=O)CCC(C)C3 |
| InChI | InChI=1S/C24H29N3O4S2/c1-6-27-23(29)20-16-9-7-13(2)11-19(16)33-22(20)26-24(27)32-14(3)21(28)25-15-8-10-17(30-4)18(12-15)31-5/h8,10,12-14H,6-7,9,11H2,1-5H3,(H,25,28) |
| InChIKey | ZSBJGINPJAKAOM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |