C23H21FN2O5S — CID 46619844
[1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 46619844) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is [1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46619844 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [1-(3-fluoroanilino)-1-oxopropan-2-yl] 4-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)OC(C)C(=O)Nc3cccc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O5S/c1-15-6-10-19(11-7-15)26-32(29,30)21-12-8-17(9-13-21)23(28)31-16(2)22(27)25-20-5-3-4-18(24)14-20/h3-14,16,26H,1-2H3,(H,25,27) |
| InChIKey | SILVCLYQYKZJSE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |