C19H14F3N3O6 — CID 46619919
[1-oxo-1-[3-oxo-6-(trifluoromethyl)-2,4-dihydroquinoxalin-1-yl]propan-2-yl] 3-nitrobenzoate (PubChem CID 46619919) has the molecular formula C19H14F3N3O6 and a molecular weight of 437.33 g/mol. Its IUPAC name is [1-oxo-1-[3-oxo-6-(trifluoromethyl)-2,4-dihydroquinoxalin-1-yl]propan-2-yl] 3-nitrobenzoate.
| Compound Name | [1-oxo-1-[3-oxo-6-(trifluoromethyl)-2,4-dihydroquinoxalin-1-yl]propan-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 46619919 |
| Molecular Formula | C19H14F3N3O6 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [1-oxo-1-[3-oxo-6-(trifluoromethyl)-2,4-dihydroquinoxalin-1-yl]propan-2-yl] 3-nitrobenzoate |
| SMILES | CC(OC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CC(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H14F3N3O6/c1-10(31-18(28)11-3-2-4-13(7-11)25(29)30)17(27)24-9-16(26)23-14-8-12(19(20,21)22)5-6-15(14)24/h2-8,10H,9H2,1H3,(H,23,26) |
| InChIKey | IVCMYPDILAKWTR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|