C16H15N3O4S2 — CID 46620208
2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-sulfamoylphenyl)propanamide (PubChem CID 46620208) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 46620208 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-sulfamoylphenyl)propanamide |
| SMILES | CC(Sc1nc2ccccc2o1)C(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-10(24-16-19-13-7-2-3-8-14(13)23-16)15(20)18-11-5-4-6-12(9-11)25(17,21)22/h2-10H,1H3,(H,18,20)(H2,17,21,22) |
| InChIKey | LSMHGOTWSMXVQO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |