C17H13F11N2O2 — CID 4662117
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-propan-2-yloxyphenyl)methylideneamino]cyclohexane-1-carboxamide (PubChem CID 4662117) has the molecular formula C17H13F11N2O2 and a molecular weight of 486.28 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-propan-2-yloxyphenyl)methylideneamino]cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-propan-2-yloxyphenyl)methylideneamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4662117 |
| Molecular Formula | C17H13F11N2O2 |
| Molecular Weight | 486.28 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[(4-propan-2-yloxyphenyl)methylideneamino]cyclohexane-1-carboxamide |
| SMILES | CC(C)Oc1ccc(C=NNC(=O)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C17H13F11N2O2/c1-8(2)32-10-5-3-9(4-6-10)7-29-30-11(31)12(18)13(19,20)15(23,24)17(27,28)16(25,26)14(12,21)22/h3-8H,1-2H3,(H,30,31) |
| InChIKey | PXIDRIBCZCDBGK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|