C19H17ClN2O6 — CID 46621606
[1-(2-nitroanilino)-1-oxopropan-2-yl] 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 46621606) has the molecular formula C19H17ClN2O6 and a molecular weight of 404.81 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 46621606 |
| Molecular Formula | C19H17ClN2O6 |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CC(OC(=O)C1COc2ccc(Cl)cc2C1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17ClN2O6/c1-11(18(23)21-15-4-2-3-5-16(15)22(25)26)28-19(24)13-8-12-9-14(20)6-7-17(12)27-10-13/h2-7,9,11,13H,8,10H2,1H3,(H,21,23) |
| InChIKey | QWJFLPODOPUVOR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|