C18H20N2O5S — CID 46623738
[1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-sulfamoylbenzoate (PubChem CID 46623738) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-sulfamoylbenzoate.
| Compound Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46623738 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 4-sulfamoylbenzoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)c2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-11-4-9-16(12(2)10-11)20-17(21)13(3)25-18(22)14-5-7-15(8-6-14)26(19,23)24/h4-10,13H,1-3H3,(H,20,21)(H2,19,23,24) |
| InChIKey | RFFNPJRPTITQRK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |