C21H32N2O5S — CID 46624780
[1-(tert-butylamino)-1-oxopropan-2-yl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate (PubChem CID 46624780) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate.
| Compound Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46624780 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [1-(tert-butylamino)-1-oxopropan-2-yl] 4-[cyclohexyl(methyl)sulfamoyl]benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)N(C)C2CCCCC2)cc1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H32N2O5S/c1-15(19(24)22-21(2,3)4)28-20(25)16-11-13-18(14-12-16)29(26,27)23(5)17-9-7-6-8-10-17/h11-15,17H,6-10H2,1-5H3,(H,22,24) |
| InChIKey | MZYWDKAZGSQVPW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |