C17H25NO5 — CID 46624841
[1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-methylpentanoate (PubChem CID 46624841) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-methylpentanoate.
| Compound Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 46624841 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-methylpentanoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)CCC(C)C)cc1OC |
| InChI | InChI=1S/C17H25NO5/c1-11(2)6-9-16(19)23-12(3)17(20)18-13-7-8-14(21-4)15(10-13)22-5/h7-8,10-12H,6,9H2,1-5H3,(H,18,20) |
| InChIKey | VUWRIQYFFMRRCX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |