About [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate
[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate (PubChem CID 46625082) has the molecular formula C22H20FN3O3S
and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate.
Molecular Properties
| Compound Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate |
| PubChem CID | 46625082 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate |
| SMILES | CCc1nc2ccccc2n1CC(=O)OCc1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H20FN3O3S/c1-2-20-25-18-5-3-4-6-19(18)26(20)11-22(27)29-12-16-14-30-21(24-16)13-28-17-9-7-15(23)8-10-17/h3-10,14H,2,11-13H2,1H3 |
| InChIKey | VZYSDVPZCCWIDU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate?
The IUPAC name of [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate (CID 46625082) is [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate.
What is the SMILES notation for [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate?
The canonical SMILES for [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate is CCc1nc2ccccc2n1CC(=O)OCc1csc(COc2ccc(F)cc2)n1.
What is the InChIKey of [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate?
The InChIKey is VZYSDVPZCCWIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O3S/c1-2-20-25-18-5-3-4-6-19(18)26(20)11-22(27)29-12-16-14-30-21(24-16)13-28-17-9-7-15(23)8-10-17/h3-10,14H,2,11-13H2,1H3.
What are the key properties of [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate?
[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate has a molecular weight of 425.49 g/mol, XLogP of 4.52, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl 2-(2-ethylbenzimidazol-1-yl)acetate is sourced from PubChem (CID 46625082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).